C20H18N2O5 — CID 18076859
[4-(2-methoxy-2-oxoethyl)phenyl] 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate (PubChem CID 18076859) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is [4-(2-methoxy-2-oxoethyl)phenyl] 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate.
| Compound Name | [4-(2-methoxy-2-oxoethyl)phenyl] 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 18076859 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [4-(2-methoxy-2-oxoethyl)phenyl] 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate |
| SMILES | COC(=O)Cc1ccc(OC(=O)C2=NN(c3ccccc3)C(=O)CC2)cc1 |
| InChI | InChI=1S/C20H18N2O5/c1-26-19(24)13-14-7-9-16(10-8-14)27-20(25)17-11-12-18(23)22(21-17)15-5-3-2-4-6-15/h2-10H,11-13H2,1H3 |
| InChIKey | JADGDCUJICMEJO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|