C14H15N3O5 — CID 75404080
[4-(methoxycarbonylamino)phenyl] 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate (PubChem CID 75404080) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is [4-(methoxycarbonylamino)phenyl] 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate.
| Compound Name | [4-(methoxycarbonylamino)phenyl] 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 75404080 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | [4-(methoxycarbonylamino)phenyl] 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate |
| SMILES | COC(=O)Nc1ccc(OC(=O)C2=NN(C)C(=O)CC2)cc1 |
| InChI | InChI=1S/C14H15N3O5/c1-17-12(18)8-7-11(16-17)13(19)22-10-5-3-9(4-6-10)15-14(20)21-2/h3-6H,7-8H2,1-2H3,(H,15,20) |
| InChIKey | HATKANWHCPCTQI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|