C17H18N4O4 — CID 56784237
[4-(methoxycarbonylamino)phenyl] 6-pyrrolidin-1-ylpyridazine-3-carboxylate (PubChem CID 56784237) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is [4-(methoxycarbonylamino)phenyl] 6-pyrrolidin-1-ylpyridazine-3-carboxylate.
| Compound Name | [4-(methoxycarbonylamino)phenyl] 6-pyrrolidin-1-ylpyridazine-3-carboxylate |
|---|---|
| PubChem CID | 56784237 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [4-(methoxycarbonylamino)phenyl] 6-pyrrolidin-1-ylpyridazine-3-carboxylate |
| SMILES | COC(=O)Nc1ccc(OC(=O)c2ccc(N3CCCC3)nn2)cc1 |
| InChI | InChI=1S/C17H18N4O4/c1-24-17(23)18-12-4-6-13(7-5-12)25-16(22)14-8-9-15(20-19-14)21-10-2-3-11-21/h4-9H,2-3,10-11H2,1H3,(H,18,23) |
| InChIKey | DKTJEBWFHSODBD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|