C19H16N2O4 — CID 18076844
(3-acetylphenyl) 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate (PubChem CID 18076844) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is (3-acetylphenyl) 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate.
| Compound Name | (3-acetylphenyl) 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 18076844 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (3-acetylphenyl) 6-oxo-1-phenyl-4,5-dihydropyridazine-3-carboxylate |
| SMILES | CC(=O)c1cccc(OC(=O)C2=NN(c3ccccc3)C(=O)CC2)c1 |
| InChI | InChI=1S/C19H16N2O4/c1-13(22)14-6-5-9-16(12-14)25-19(24)17-10-11-18(23)21(20-17)15-7-3-2-4-8-15/h2-9,12H,10-11H2,1H3 |
| InChIKey | DHYWKVFWEPLNAE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|