C17H10F4N2O3 — CID 8765257
phenyl 6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxylate (PubChem CID 8765257) has the molecular formula C17H10F4N2O3 and a molecular weight of 366.27 g/mol. Its IUPAC name is phenyl 6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxylate.
| Compound Name | phenyl 6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 8765257 |
| Molecular Formula | C17H10F4N2O3 |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | phenyl 6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxylate |
| SMILES | O=C(Oc1ccccc1)C1=NN(c2c(F)c(F)cc(F)c2F)C(=O)CC1 |
| InChI | InChI=1S/C17H10F4N2O3/c18-10-8-11(19)15(21)16(14(10)20)23-13(24)7-6-12(22-23)17(25)26-9-4-2-1-3-5-9/h1-5,8H,6-7H2 |
| InChIKey | AVHVMTBNBDWNLJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|