C18H13F4N3O2S — CID 9179539
N-(4-methylsulfanylphenyl)-6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxamide (PubChem CID 9179539) has the molecular formula C18H13F4N3O2S and a molecular weight of 411.38 g/mol. Its IUPAC name is N-(4-methylsulfanylphenyl)-6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | N-(4-methylsulfanylphenyl)-6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 9179539 |
| Molecular Formula | C18H13F4N3O2S |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | N-(4-methylsulfanylphenyl)-6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxamide |
| SMILES | CSc1ccc(NC(=O)C2=NN(c3c(F)c(F)cc(F)c3F)C(=O)CC2)cc1 |
| InChI | InChI=1S/C18H13F4N3O2S/c1-28-10-4-2-9(3-5-10)23-18(27)13-6-7-14(26)25(24-13)17-15(21)11(19)8-12(20)16(17)22/h2-5,8H,6-7H2,1H3,(H,23,27) |
| InChIKey | WGAGACDNDQGXMO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|