C13H7F4N3O3 — CID 7971203
cyanomethyl 6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxylate (PubChem CID 7971203) has the molecular formula C13H7F4N3O3 and a molecular weight of 329.21 g/mol. Its IUPAC name is cyanomethyl 6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxylate.
| Compound Name | cyanomethyl 6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 7971203 |
| Molecular Formula | C13H7F4N3O3 |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | cyanomethyl 6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxylate |
| SMILES | N#CCOC(=O)C1=NN(c2c(F)c(F)cc(F)c2F)C(=O)CC1 |
| InChI | InChI=1S/C13H7F4N3O3/c14-6-5-7(15)11(17)12(10(6)16)20-9(21)2-1-8(19-20)13(22)23-4-3-18/h5H,1-2,4H2 |
| InChIKey | CGIOEJLUNJQAET-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 82.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|