About propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate
propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate (PubChem CID 112724973) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate.
Analyze propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate?
The IUPAC name of propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate (CID 112724973) is propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate.
What is the SMILES notation for propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate?
The canonical SMILES for propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate is CCCOC(=O)C1=NN(C)C(=O)CC1.
What is the InChIKey of propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate?
The InChIKey is JTLRFEKZGCQXNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-3-6-14-9(13)7-4-5-8(12)11(2)10-7/h3-6H2,1-2H3.
What are the key properties of propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate?
propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate has a molecular weight of 198.22 g/mol, XLogP of 0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate is sourced from PubChem (CID 112724973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).