C13H11F4NO3 — CID 2420777
2-(2-oxopyrrolidin-1-yl)ethyl 2,3,4,5-tetrafluorobenzoate (PubChem CID 2420777) has the molecular formula C13H11F4NO3 and a molecular weight of 305.23 g/mol. Its IUPAC name is 2-(2-oxopyrrolidin-1-yl)ethyl 2,3,4,5-tetrafluorobenzoate.
| Compound Name | 2-(2-oxopyrrolidin-1-yl)ethyl 2,3,4,5-tetrafluorobenzoate |
|---|---|
| PubChem CID | 2420777 |
| Molecular Formula | C13H11F4NO3 |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-(2-oxopyrrolidin-1-yl)ethyl 2,3,4,5-tetrafluorobenzoate |
| SMILES | O=C(OCCN1CCCC1=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H11F4NO3/c14-8-6-7(10(15)12(17)11(8)16)13(20)21-5-4-18-3-1-2-9(18)19/h6H,1-5H2 |
| InChIKey | XEGWYDWVPSQQGU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|