C8H10F2NO6S- — CID 58520241
1,1-difluoro-2-oxo-2-[2-(2-oxopyrrolidin-1-yl)ethoxy]ethanesulfonate (PubChem CID 58520241) has the molecular formula C8H10F2NO6S- and a molecular weight of 286.23 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[2-(2-oxopyrrolidin-1-yl)ethoxy]ethanesulfonate.
| Compound Name | 1,1-difluoro-2-oxo-2-[2-(2-oxopyrrolidin-1-yl)ethoxy]ethanesulfonate |
|---|---|
| PubChem CID | 58520241 |
| Molecular Formula | C8H10F2NO6S- |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[2-(2-oxopyrrolidin-1-yl)ethoxy]ethanesulfonate |
| SMILES | O=C1CCCN1CCOC(=O)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C8H11F2NO6S/c9-8(10,18(14,15)16)7(13)17-5-4-11-3-1-2-6(11)12/h1-5H2,(H,14,15,16)/p-1 |
| InChIKey | KAPVMAZQUFVAFG-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|