C17H10ClF4N3O2 — CID 9411179
N-(2-chlorophenyl)-6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxamide (PubChem CID 9411179) has the molecular formula C17H10ClF4N3O2 and a molecular weight of 399.73 g/mol. Its IUPAC name is N-(2-chlorophenyl)-6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | N-(2-chlorophenyl)-6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 9411179 |
| Molecular Formula | C17H10ClF4N3O2 |
| Molecular Weight | 399.73 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | N-(2-chlorophenyl)-6-oxo-1-(2,3,5,6-tetrafluorophenyl)-4,5-dihydropyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)C1=NN(c2c(F)c(F)cc(F)c2F)C(=O)CC1 |
| InChI | InChI=1S/C17H10ClF4N3O2/c18-8-3-1-2-4-11(8)23-17(27)12-5-6-13(26)25(24-12)16-14(21)9(19)7-10(20)15(16)22/h1-4,7H,5-6H2,(H,23,27) |
| InChIKey | IVOOQFCARUMOGB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.73 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|