C14H10F3NOS — CID 63188297
3,4,5-trifluoro-N-(4-methylsulfanylphenyl)benzamide (PubChem CID 63188297) has the molecular formula C14H10F3NOS and a molecular weight of 297.30 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-(4-methylsulfanylphenyl)benzamide.
| Compound Name | 3,4,5-trifluoro-N-(4-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 63188297 |
| Molecular Formula | C14H10F3NOS |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 3,4,5-trifluoro-N-(4-methylsulfanylphenyl)benzamide |
| SMILES | CSc1ccc(NC(=O)c2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C14H10F3NOS/c1-20-10-4-2-9(3-5-10)18-14(19)8-6-11(15)13(17)12(16)7-8/h2-7H,1H3,(H,18,19) |
| InChIKey | RXGRJKMORGVRFK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|