C21H23NO7S2 — CID 24581006
(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-morpholin-4-ylsulfonylbenzenesulfonate (PubChem CID 24581006) has the molecular formula C21H23NO7S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-morpholin-4-ylsulfonylbenzenesulfonate.
| Compound Name | (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-morpholin-4-ylsulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 24581006 |
| Molecular Formula | C21H23NO7S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 4-morpholin-4-ylsulfonylbenzenesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)c2c1C(C)CC2=O |
| InChI | InChI=1S/C21H23NO7S2/c1-14-3-8-19(21-18(23)13-15(2)20(14)21)29-31(26,27)17-6-4-16(5-7-17)30(24,25)22-9-11-28-12-10-22/h3-8,15H,9-13H2,1-2H3 |
| InChIKey | LHNMNQPWAULJDF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|