C8H3BrINO2 — CID 18518602
4-bromo-6-iodo-1H-indole-2,3-dione (PubChem CID 18518602) has the molecular formula C8H3BrINO2 and a molecular weight of 351.93 g/mol. Its IUPAC name is 4-bromo-6-iodo-1H-indole-2,3-dione.
| Compound Name | 4-bromo-6-iodo-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 18518602 |
| Molecular Formula | C8H3BrINO2 |
| Molecular Weight | 351.93 g/mol |
| Exact Mass | 350.84 |
| IUPAC Name | 4-bromo-6-iodo-1H-indole-2,3-dione |
| SMILES | O=C1Nc2cc(I)cc(Br)c2C1=O |
| InChI | InChI=1S/C8H3BrINO2/c9-4-1-3(10)2-5-6(4)7(12)8(13)11-5/h1-2H,(H,11,12,13) |
| InChIKey | UZEVXGGWZYNVRA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.93 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|