C27H34O — CID 164518953
2,3-bis(4-tert-butyl-2,6-dimethylphenyl)cycloprop-2-en-1-one (PubChem CID 164518953) has the molecular formula C27H34O and a molecular weight of 374.57 g/mol. Its IUPAC name is 2,3-bis(4-tert-butyl-2,6-dimethylphenyl)cycloprop-2-en-1-one.
| Compound Name | 2,3-bis(4-tert-butyl-2,6-dimethylphenyl)cycloprop-2-en-1-one |
|---|---|
| PubChem CID | 164518953 |
| Molecular Formula | C27H34O |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 2,3-bis(4-tert-butyl-2,6-dimethylphenyl)cycloprop-2-en-1-one |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1-c1c(-c2c(C)cc(C(C)(C)C)cc2C)c1=O |
| InChI | InChI=1S/C27H34O/c1-15-11-19(26(5,6)7)12-16(2)21(15)23-24(25(23)28)22-17(3)13-20(14-18(22)4)27(8,9)10/h11-14H,1-10H3 |
| InChIKey | ODESIOKZCSGPRO-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |