C28H35P — CID 134984575
[4-tert-butyl-2,6-bis(2,4,6-trimethylphenyl)phenyl]phosphane (PubChem CID 134984575) has the molecular formula C28H35P and a molecular weight of 402.56 g/mol. Its IUPAC name is [4-tert-butyl-2,6-bis(2,4,6-trimethylphenyl)phenyl]phosphane.
| Compound Name | [4-tert-butyl-2,6-bis(2,4,6-trimethylphenyl)phenyl]phosphane |
|---|---|
| PubChem CID | 134984575 |
| Molecular Formula | C28H35P |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | [4-tert-butyl-2,6-bis(2,4,6-trimethylphenyl)phenyl]phosphane |
| SMILES | Cc1cc(C)c(-c2cc(C(C)(C)C)cc(-c3c(C)cc(C)cc3C)c2P)c(C)c1 |
| InChI | InChI=1S/C28H35P/c1-16-10-18(3)25(19(4)11-16)23-14-22(28(7,8)9)15-24(27(23)29)26-20(5)12-17(2)13-21(26)6/h10-15H,29H2,1-9H3 |
| InChIKey | NYIVDVICNMTDRA-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|