C38H47BrN2 — CID 176781916
1-N-[5-bromo-2-(2,4,6-trimethylphenyl)phenyl]-3,5-ditert-butyl-2-N-(2,4,6-trimethylphenyl)benzene-1,2-diamine (PubChem CID 176781916) has the molecular formula C38H47BrN2 and a molecular weight of 611.71 g/mol. Its IUPAC name is 1-N-[5-bromo-2-(2,4,6-trimethylphenyl)phenyl]-3,5-ditert-butyl-2-N-(2,4,6-trimethylphenyl)benzene-1,2-diamine.
| Compound Name | 1-N-[5-bromo-2-(2,4,6-trimethylphenyl)phenyl]-3,5-ditert-butyl-2-N-(2,4,6-trimethylphenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 176781916 |
| Molecular Formula | C38H47BrN2 |
| Molecular Weight | 611.71 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | 1-N-[5-bromo-2-(2,4,6-trimethylphenyl)phenyl]-3,5-ditert-butyl-2-N-(2,4,6-trimethylphenyl)benzene-1,2-diamine |
| SMILES | Cc1cc(C)c(Nc2c(Nc3cc(Br)ccc3-c3c(C)cc(C)cc3C)cc(C(C)(C)C)cc2C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C38H47BrN2/c1-22-15-24(3)34(25(4)16-22)30-14-13-29(39)21-32(30)40-33-20-28(37(7,8)9)19-31(38(10,11)12)36(33)41-35-26(5)17-23(2)18-27(35)6/h13-21,40-41H,1-12H3 |
| InChIKey | RWOLIERNWXYRTP-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.71 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |