About 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline
4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline (PubChem CID 146643062) has the molecular formula C22H31N
and a molecular weight of 309.50 g/mol. Its IUPAC name is 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline |
| PubChem CID | 146643062 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H31N/c1-15-13-18(22(6,7)8)14-16(2)20(15)23-19-11-9-17(10-12-19)21(3,4)5/h9-14,23H,1-8H3 |
| InChIKey | WMPJOFOKFYDCFO-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline?
The IUPAC name of 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline (CID 146643062) is 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline.
What is the SMILES notation for 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline?
The canonical SMILES for 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline is Cc1cc(C(C)(C)C)cc(C)c1Nc1ccc(C(C)(C)C)cc1.
What is the InChIKey of 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline?
The InChIKey is WMPJOFOKFYDCFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N/c1-15-13-18(22(6,7)8)14-16(2)20(15)23-19-11-9-17(10-12-19)21(3,4)5/h9-14,23H,1-8H3.
What are the key properties of 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline?
4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline has a molecular weight of 309.50 g/mol, XLogP of 6.64, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline is sourced from PubChem (CID 146643062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).