C22H31N — CID 146643062
4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline (PubChem CID 146643062) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline.
| Compound Name | 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline |
|---|---|
| PubChem CID | 146643062 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 4-tert-butyl-N-(4-tert-butylphenyl)-2,6-dimethylaniline |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H31N/c1-15-13-18(22(6,7)8)14-16(2)20(15)23-19-11-9-17(10-12-19)21(3,4)5/h9-14,23H,1-8H3 |
| InChIKey | WMPJOFOKFYDCFO-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |