C26H28O4 — CID 100972739
6,13-ditert-butyl-15,16-dimethyltricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-2,3,9,10-tetrone (PubChem CID 100972739) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 6,13-ditert-butyl-15,16-dimethyltricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-2,3,9,10-tetrone.
| Compound Name | 6,13-ditert-butyl-15,16-dimethyltricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-2,3,9,10-tetrone |
|---|---|
| PubChem CID | 100972739 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 6,13-ditert-butyl-15,16-dimethyltricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-2,3,9,10-tetrone |
| SMILES | Cc1c2cc(C(C)(C)C)cc1c(=O)c(=O)c1cc(C(C)(C)C)cc(c1C)c(=O)c2=O |
| InChI | InChI=1S/C26H28O4/c1-13-17-9-15(25(3,4)5)10-18(13)22(28)24(30)20-12-16(26(6,7)8)11-19(14(20)2)23(29)21(17)27/h9-12H,1-8H3 |
| InChIKey | GAWHICLHRQXZHA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|