C10H2O4 — CID 102324557
tricyclo[6.2.0.03,6]deca-1(8),2,6-triene-4,5,9,10-tetrone (PubChem CID 102324557) has the molecular formula C10H2O4 and a molecular weight of 186.12 g/mol. Its IUPAC name is tricyclo[6.2.0.03,6]deca-1(8),2,6-triene-4,5,9,10-tetrone.
| Compound Name | tricyclo[6.2.0.03,6]deca-1(8),2,6-triene-4,5,9,10-tetrone |
|---|---|
| PubChem CID | 102324557 |
| Molecular Formula | C10H2O4 |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | tricyclo[6.2.0.03,6]deca-1(8),2,6-triene-4,5,9,10-tetrone |
| SMILES | O=c1c(=O)c2cc3c(=O)c(=O)c3cc12 |
| InChI | InChI=1S/C10H2O4/c11-7-3-1-4-6(10(14)8(4)12)2-5(3)9(7)13/h1-2H |
| InChIKey | LQBWKDJNDPSKHG-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|