C18H10O6 — CID 153364564
2,7-dimethoxypyrene-4,5,9,10-tetrone (PubChem CID 153364564) has the molecular formula C18H10O6 and a molecular weight of 322.27 g/mol. Its IUPAC name is 2,7-dimethoxypyrene-4,5,9,10-tetrone.
| Compound Name | 2,7-dimethoxypyrene-4,5,9,10-tetrone |
|---|---|
| PubChem CID | 153364564 |
| Molecular Formula | C18H10O6 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2,7-dimethoxypyrene-4,5,9,10-tetrone |
| SMILES | COc1cc2c3c(c1)c(=O)c(=O)c1cc(OC)cc(c1-3)c(=O)c2=O |
| InChI | InChI=1S/C18H10O6/c1-23-7-3-9-13-10(4-7)16(20)18(22)12-6-8(24-2)5-11(14(12)13)17(21)15(9)19/h3-6H,1-2H3 |
| InChIKey | DBJMBAYGTREANH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|