C13H6O3 — CID 581122
cyclopenta[b]naphthalene-1,2,3-trione (PubChem CID 581122) has the molecular formula C13H6O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is cyclopenta[b]naphthalene-1,2,3-trione.
| Compound Name | cyclopenta[b]naphthalene-1,2,3-trione |
|---|---|
| PubChem CID | 581122 |
| Molecular Formula | C13H6O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | cyclopenta[b]naphthalene-1,2,3-trione |
| SMILES | O=c1c(=O)c2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C13H6O3/c14-11-9-5-7-3-1-2-4-8(7)6-10(9)12(15)13(11)16/h1-6H |
| InChIKey | LGJRHILJQNOJAT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|