C12H6O4 — CID 164673026
benzo[g][2,3]benzodioxine-1,4-dione (PubChem CID 164673026) has the molecular formula C12H6O4 and a molecular weight of 214.18 g/mol. Its IUPAC name is benzo[g][2,3]benzodioxine-1,4-dione.
| Compound Name | benzo[g][2,3]benzodioxine-1,4-dione |
|---|---|
| PubChem CID | 164673026 |
| Molecular Formula | C12H6O4 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | benzo[g][2,3]benzodioxine-1,4-dione |
| SMILES | O=c1ooc(=O)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C12H6O4/c13-11-9-5-7-3-1-2-4-8(7)6-10(9)12(14)16-15-11/h1-6H |
| InChIKey | IFEGAMPGOISJQT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|