C13H7NO3 — CID 12583820
2-hydroxyiminocyclopenta[b]naphthalene-1,3-dione (PubChem CID 12583820) has the molecular formula C13H7NO3 and a molecular weight of 225.20 g/mol. Its IUPAC name is 2-hydroxyiminocyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-hydroxyiminocyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 12583820 |
| Molecular Formula | C13H7NO3 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-hydroxyiminocyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=c1c(=NO)c(=O)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C13H7NO3/c15-12-9-5-7-3-1-2-4-8(7)6-10(9)13(16)11(12)14-17/h1-6,17H |
| InChIKey | KFTAZKAKHISVFE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|