C16H4F2O2S2 — CID 58224410
6,15-difluoro-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-9,18-dione (PubChem CID 58224410) has the molecular formula C16H4F2O2S2 and a molecular weight of 330.34 g/mol. Its IUPAC name is 6,15-difluoro-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-9,18-dione.
| Compound Name | 6,15-difluoro-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-9,18-dione |
|---|---|
| PubChem CID | 58224410 |
| Molecular Formula | C16H4F2O2S2 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 6,15-difluoro-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-9,18-dione |
| SMILES | O=c1c2cc3c(cc2c2sc(F)cc12)c(=O)c1cc(F)sc13 |
| InChI | InChI=1S/C16H4F2O2S2/c17-11-4-10-14(20)6-2-8-5(1-7(6)15(10)21-11)13(19)9-3-12(18)22-16(8)9/h1-4H |
| InChIKey | VDRVZBPHQGJBDO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |