C34H18O2S4 — CID 58224222
6,15-bis(5-methyl-1-benzothiophen-2-yl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-9,18-dione (PubChem CID 58224222) has the molecular formula C34H18O2S4 and a molecular weight of 586.78 g/mol. Its IUPAC name is 6,15-bis(5-methyl-1-benzothiophen-2-yl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-9,18-dione.
| Compound Name | 6,15-bis(5-methyl-1-benzothiophen-2-yl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-9,18-dione |
|---|---|
| PubChem CID | 58224222 |
| Molecular Formula | C34H18O2S4 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.02 |
| IUPAC Name | 6,15-bis(5-methyl-1-benzothiophen-2-yl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-9,18-dione |
| SMILES | Cc1ccc2sc(-c3cc4c(=O)c5cc6c(cc5c4s3)c(=O)c3cc(-c4cc5cc(C)ccc5s4)sc36)cc2c1 |
| InChI | InChI=1S/C34H18O2S4/c1-15-3-5-25-17(7-15)9-27(37-25)29-13-23-31(35)19-12-22-20(11-21(19)33(23)39-29)32(36)24-14-30(40-34(22)24)28-10-18-8-16(2)4-6-26(18)38-28/h3-14H,1-2H3 |
| InChIKey | APMFYJWCZRRGKY-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |