C18H6O6 — CID 58805602
5-(1,2,3-trioxoinden-5-yl)indene-1,2,3-trione (PubChem CID 58805602) has the molecular formula C18H6O6 and a molecular weight of 318.24 g/mol. Its IUPAC name is 5-(1,2,3-trioxoinden-5-yl)indene-1,2,3-trione.
| Compound Name | 5-(1,2,3-trioxoinden-5-yl)indene-1,2,3-trione |
|---|---|
| PubChem CID | 58805602 |
| Molecular Formula | C18H6O6 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 5-(1,2,3-trioxoinden-5-yl)indene-1,2,3-trione |
| SMILES | O=c1c(=O)c2ccc(-c3ccc4c(=O)c(=O)c(=O)c4c3)cc2c1=O |
| InChI | InChI=1S/C18H6O6/c19-13-9-3-1-7(5-11(9)15(21)17(13)23)8-2-4-10-12(6-8)16(22)18(24)14(10)20/h1-6H |
| InChIKey | BPZNXXZITCLCAB-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|