C27H16N2O3 — CID 59944980
17,19-dimethyl-6-phenyl-2,12-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,7,12,15,17,19-nonaene-10,14,21-trione (PubChem CID 59944980) has the molecular formula C27H16N2O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is 17,19-dimethyl-6-phenyl-2,12-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,7,12,15,17,19-nonaene-10,14,21-trione.
| Compound Name | 17,19-dimethyl-6-phenyl-2,12-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,7,12,15,17,19-nonaene-10,14,21-trione |
|---|---|
| PubChem CID | 59944980 |
| Molecular Formula | C27H16N2O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 17,19-dimethyl-6-phenyl-2,12-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,7,12,15,17,19-nonaene-10,14,21-trione |
| SMILES | Cc1cc(C)c2c(=O)c3nc4c(nc3c(=O)c2c1)c(=O)c1ccc(-c2ccccc2)cc14 |
| InChI | InChI=1S/C27H16N2O3/c1-13-10-14(2)20-19(11-13)26(31)23-24(27(20)32)28-21-18-12-16(15-6-4-3-5-7-15)8-9-17(18)25(30)22(21)29-23/h3-12H,1-2H3 |
| InChIKey | XISJOTBXAOKDAJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|