About 2,6,11-tris(3,5-dimethylphenyl)triphenylene
2,6,11-tris(3,5-dimethylphenyl)triphenylene (PubChem CID 58219987) has the molecular formula C42H36
and a molecular weight of 540.75 g/mol. Its IUPAC name is 2,6,11-tris(3,5-dimethylphenyl)triphenylene.
Molecular Properties
| Compound Name | 2,6,11-tris(3,5-dimethylphenyl)triphenylene |
| PubChem CID | 58219987 |
| Molecular Formula | C42H36 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | 2,6,11-tris(3,5-dimethylphenyl)triphenylene |
| SMILES | Cc1cc(C)cc(-c2ccc3c4ccc(-c5cc(C)cc(C)c5)cc4c4cc(-c5cc(C)cc(C)c5)ccc4c3c2)c1 |
| InChI | InChI=1S/C42H36/c1-25-13-26(2)17-34(16-25)31-7-10-37-38-11-8-32(35-18-27(3)14-28(4)19-35)23-41(38)42-24-33(9-12-39(42)40(37)22-31)36-20-29(5)15-30(6)21-36/h7-24H,1-6H3 |
| InChIKey | UNPLQKQXOLWECP-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,6,11-tris(3,5-dimethylphenyl)triphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6,11-tris(3,5-dimethylphenyl)triphenylene?
The IUPAC name of 2,6,11-tris(3,5-dimethylphenyl)triphenylene (CID 58219987) is 2,6,11-tris(3,5-dimethylphenyl)triphenylene.
What is the SMILES notation for 2,6,11-tris(3,5-dimethylphenyl)triphenylene?
The canonical SMILES for 2,6,11-tris(3,5-dimethylphenyl)triphenylene is Cc1cc(C)cc(-c2ccc3c4ccc(-c5cc(C)cc(C)c5)cc4c4cc(-c5cc(C)cc(C)c5)ccc4c3c2)c1.
What is the InChIKey of 2,6,11-tris(3,5-dimethylphenyl)triphenylene?
The InChIKey is UNPLQKQXOLWECP-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H36/c1-25-13-26(2)17-34(16-25)31-7-10-37-38-11-8-32(35-18-27(3)14-28(4)19-35)23-41(38)42-24-33(9-12-39(42)40(37)22-31)36-20-29(5)15-30(6)21-36/h7-24H,1-6H3.
What are the key properties of 2,6,11-tris(3,5-dimethylphenyl)triphenylene?
2,6,11-tris(3,5-dimethylphenyl)triphenylene has a molecular weight of 540.75 g/mol, XLogP of 12.00, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6,11-tris(3,5-dimethylphenyl)triphenylene is sourced from PubChem (CID 58219987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).