C12H13BN3O2- — CID 59961018
(3S)-6,8-dimethyl-3-(oxoboranylmethylideneamino)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (PubChem CID 59961018) has the molecular formula C12H13BN3O2- and a molecular weight of 242.07 g/mol. Its IUPAC name is (3S)-6,8-dimethyl-3-(oxoboranylmethylideneamino)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one.
| Compound Name | (3S)-6,8-dimethyl-3-(oxoboranylmethylideneamino)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 59961018 |
| Molecular Formula | C12H13BN3O2- |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (3S)-6,8-dimethyl-3-(oxoboranylmethylideneamino)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| SMILES | Cc1cc(C)c2c(c1)NC[C@H](/N=[C-]/B=O)C(=O)N2 |
| InChI | InChI=1S/C12H13BN3O2/c1-7-3-8(2)11-9(4-7)14-5-10(12(17)16-11)15-6-13-18/h3-4,10,14H,5H2,1-2H3,(H,16,17)/q-1/t10-/m0/s1 |
| InChIKey | GHQJKBYGKLFHPE-JTQLQIEISA-N |
| XLogP | 0.99 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|