C13H18ClNOS — CID 178049033
6-chloro-2-methyl-4-propoxy-1,3-benzothiazole;ethane (PubChem CID 178049033) has the molecular formula C13H18ClNOS and a molecular weight of 271.81 g/mol. Its IUPAC name is 6-chloro-2-methyl-4-propoxy-1,3-benzothiazole;ethane.
| Compound Name | 6-chloro-2-methyl-4-propoxy-1,3-benzothiazole;ethane |
|---|---|
| PubChem CID | 178049033 |
| Molecular Formula | C13H18ClNOS |
| Molecular Weight | 271.81 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 6-chloro-2-methyl-4-propoxy-1,3-benzothiazole;ethane |
| SMILES | CC.CCCOc1cc(Cl)cc2sc(C)nc12 |
| InChI | InChI=1S/C11H12ClNOS.C2H6/c1-3-4-14-9-5-8(12)6-10-11(9)13-7(2)15-10;1-2/h5-6H,3-4H2,1-2H3;1-2H3 |
| InChIKey | NPNWPZCNVRRFQH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.81 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |