C15H22N2OS — CID 43450718
5-heptoxy-2-methyl-1,3-benzothiazol-6-amine (PubChem CID 43450718) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 5-heptoxy-2-methyl-1,3-benzothiazol-6-amine.
| Compound Name | 5-heptoxy-2-methyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 43450718 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 5-heptoxy-2-methyl-1,3-benzothiazol-6-amine |
| SMILES | CCCCCCCOc1cc2nc(C)sc2cc1N |
| InChI | InChI=1S/C15H22N2OS/c1-3-4-5-6-7-8-18-14-10-13-15(9-12(14)16)19-11(2)17-13/h9-10H,3-8,16H2,1-2H3 |
| InChIKey | RRUPUKLUXQGLPP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|