C12H15FN2OS — CID 14853790
6-fluoro-2-pentoxy-1,3-benzothiazol-5-amine (PubChem CID 14853790) has the molecular formula C12H15FN2OS and a molecular weight of 254.33 g/mol. Its IUPAC name is 6-fluoro-2-pentoxy-1,3-benzothiazol-5-amine.
| Compound Name | 6-fluoro-2-pentoxy-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 14853790 |
| Molecular Formula | C12H15FN2OS |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 6-fluoro-2-pentoxy-1,3-benzothiazol-5-amine |
| SMILES | CCCCCOc1nc2cc(N)c(F)cc2s1 |
| InChI | InChI=1S/C12H15FN2OS/c1-2-3-4-5-16-12-15-10-7-9(14)8(13)6-11(10)17-12/h6-7H,2-5,14H2,1H3 |
| InChIKey | DRYWHMPXWOSGSN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|