C14H21ClO3 — CID 82268137
1-(5-chloro-2,4-dipropoxyphenyl)ethanol (PubChem CID 82268137) has the molecular formula C14H21ClO3 and a molecular weight of 272.77 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dipropoxyphenyl)ethanol.
| Compound Name | 1-(5-chloro-2,4-dipropoxyphenyl)ethanol |
|---|---|
| PubChem CID | 82268137 |
| Molecular Formula | C14H21ClO3 |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-(5-chloro-2,4-dipropoxyphenyl)ethanol |
| SMILES | CCCOc1cc(OCCC)c(C(C)O)cc1Cl |
| InChI | InChI=1S/C14H21ClO3/c1-4-6-17-13-9-14(18-7-5-2)12(15)8-11(13)10(3)16/h8-10,16H,4-7H2,1-3H3 |
| InChIKey | ZDHNGOAAQFDUKT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |