C15H23ClO4 — CID 83943493
4-(5-chloro-2,4-diethoxyphenyl)pentane-1,2-diol (PubChem CID 83943493) has the molecular formula C15H23ClO4 and a molecular weight of 302.80 g/mol. Its IUPAC name is 4-(5-chloro-2,4-diethoxyphenyl)pentane-1,2-diol.
| Compound Name | 4-(5-chloro-2,4-diethoxyphenyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 83943493 |
| Molecular Formula | C15H23ClO4 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-(5-chloro-2,4-diethoxyphenyl)pentane-1,2-diol |
| SMILES | CCOc1cc(OCC)c(C(C)CC(O)CO)cc1Cl |
| InChI | InChI=1S/C15H23ClO4/c1-4-19-14-8-15(20-5-2)13(16)7-12(14)10(3)6-11(18)9-17/h7-8,10-11,17-18H,4-6,9H2,1-3H3 |
| InChIKey | MENNVDABXPBDIF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |