C17H26BNO3 — CID 59755211
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,4-dimethyl-2-propan-2-ylpentanamide (PubChem CID 59755211) has the molecular formula C17H26BNO3 and a molecular weight of 303.21 g/mol. Its IUPAC name is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,4-dimethyl-2-propan-2-ylpentanamide.
| Compound Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,4-dimethyl-2-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 59755211 |
| Molecular Formula | C17H26BNO3 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,4-dimethyl-2-propan-2-ylpentanamide |
| SMILES | CC(C)CC(C)(C(=O)Nc1ccc2c(c1)B(O)OC2)C(C)C |
| InChI | InChI=1S/C17H26BNO3/c1-11(2)9-17(5,12(3)4)16(20)19-14-7-6-13-10-22-18(21)15(13)8-14/h6-8,11-12,21H,9-10H2,1-5H3,(H,19,20) |
| InChIKey | NYLBCZWQNBXZDO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|