C15H14BNO7S — CID 67175096
2-[5-hydroxy-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl]acetic acid (PubChem CID 67175096) has the molecular formula C15H14BNO7S and a molecular weight of 363.16 g/mol. Its IUPAC name is 2-[5-hydroxy-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl]acetic acid.
| Compound Name | 2-[5-hydroxy-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 67175096 |
| Molecular Formula | C15H14BNO7S |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-[5-hydroxy-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(O)ccc1S(=O)(=O)Nc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C15H14BNO7S/c18-12-3-4-14(10(5-12)6-15(19)20)25(22,23)17-11-2-1-9-8-24-16(21)13(9)7-11/h1-5,7,17-18,21H,6,8H2,(H,19,20) |
| InChIKey | BDJJWLUFHOAFHL-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|