C16H15BN6O4S — CID 67174157
5-amino-N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-(pyrazin-2-ylamino)pyridine-2-sulfonamide (PubChem CID 67174157) has the molecular formula C16H15BN6O4S and a molecular weight of 398.21 g/mol. Its IUPAC name is 5-amino-N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-(pyrazin-2-ylamino)pyridine-2-sulfonamide.
| Compound Name | 5-amino-N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-(pyrazin-2-ylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 67174157 |
| Molecular Formula | C16H15BN6O4S |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 5-amino-N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-(pyrazin-2-ylamino)pyridine-2-sulfonamide |
| SMILES | Nc1cnc(S(=O)(=O)Nc2ccc3c(c2)B(O)OC3)c(Nc2cnccn2)c1 |
| InChI | InChI=1S/C16H15BN6O4S/c18-11-5-14(22-15-8-19-3-4-20-15)16(21-7-11)28(25,26)23-12-2-1-10-9-27-17(24)13(10)6-12/h1-8,23-24H,9,18H2,(H,20,22) |
| InChIKey | SIJCXHWACXGFSI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 152.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|