About CID 176851645
CID 176851645 (PubChem CID 176851645) has the molecular formula C43H53IrN2O2-
and a molecular weight of 822.13 g/mol.
Molecular Properties
| Compound Name | CID 176851645 |
| PubChem CID | 176851645 |
| Molecular Formula | C43H53IrN2O2- |
| Molecular Weight | 822.13 g/mol |
| Exact Mass | 822.37 |
| IUPAC Name | — |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.Cc1[c-]c2c3nccc4c(CC(C)(C)C)ccc(c43)n3c4ccccc4c(c1C)c23.[Ir] |
| InChI | InChI=1S/C28H25N2.C15H28O2.Ir/c1-16-14-21-26-25-19(12-13-29-26)18(15-28(3,4)5)10-11-23(25)30-22-9-7-6-8-20(22)24(17(16)2)27(21)30;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h6-13H,15H2,1-5H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-; |
| InChIKey | MUUACSWVZBJBNS-SWPBDETKSA-N |
| XLogP | 12.04 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 822.13 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176851645 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176851645?
The IUPAC name of CID 176851645 (CID 176851645) is not available.
What is the SMILES notation for CID 176851645?
The canonical SMILES for CID 176851645 is CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.Cc1[c-]c2c3nccc4c(CC(C)(C)C)ccc(c43)n3c4ccccc4c(c1C)c23.[Ir].
What is the InChIKey of CID 176851645?
The InChIKey is MUUACSWVZBJBNS-SWPBDETKSA-N. The full InChI is InChI=1S/C28H25N2.C15H28O2.Ir/c1-16-14-21-26-25-19(12-13-29-26)18(15-28(3,4)5)10-11-23(25)30-22-9-7-6-8-20(22)24(17(16)2)27(21)30;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h6-13H,15H2,1-5H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-;.
What are the key properties of CID 176851645?
CID 176851645 has a molecular weight of 822.13 g/mol, XLogP of 12.04, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176851645 is sourced from PubChem (CID 176851645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).