C38H19F12IrN2O3- — CID 165160933
CID 165160933 (PubChem CID 165160933) has the molecular formula C38H19F12IrN2O3- and a molecular weight of 971.77 g/mol.
| Compound Name | CID 165160933 |
|---|---|
| PubChem CID | 165160933 |
| Molecular Formula | C38H19F12IrN2O3- |
| Molecular Weight | 971.77 g/mol |
| Exact Mass | 972.08 |
| IUPAC Name | — |
| SMILES | O=C(/C=C(\O)C(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)C(F)(F)F.[Ir].[c-]1ccc2c(oc3c4cccc5c6ccccc6n(c54)c23)c1-c1cc2ccccc2cn1 |
| InChI | InChI=1S/C29H15N2O.C9H4F12O2.Ir/c1-2-8-18-16-30-24(15-17(18)7-1)21-11-6-13-23-27-29(32-28(21)23)22-12-5-10-20-19-9-3-4-14-25(19)31(27)26(20)22;10-6(11,12)4(7(13,14)15)2(22)1-3(23)5(8(16,17)18)9(19,20)21;/h1-10,12-16H;1,4-5,22H;/q-1;;/b;2-1-; |
| InChIKey | VJKQZIRRGBKVTL-FJOGWHKWSA-N |
| XLogP | 12.07 |
| TPSA | 67.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.77 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|