C38H36F2IrNO3- — CID 176749047
CID 176749047 (PubChem CID 176749047) has the molecular formula C38H36F2IrNO3- and a molecular weight of 784.92 g/mol.
| Compound Name | CID 176749047 |
|---|---|
| PubChem CID | 176749047 |
| Molecular Formula | C38H36F2IrNO3- |
| Molecular Weight | 784.92 g/mol |
| Exact Mass | 785.23 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.FC(F)=c1ccc2c3oc4c(-c5ccccn5)[c-]ccc4c3cc3cccc1c32.[Ir] |
| InChI | InChI=1S/C25H12F2NO.C13H24O2.Ir/c26-25(27)17-10-11-19-22-14(5-3-6-15(17)22)13-20-16-7-4-8-18(23(16)29-24(19)20)21-9-1-2-12-28-21;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-7,9-13H;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | IXKBPEAGUUHMMJ-DZTQYQPZSA-N |
| XLogP | 10.35 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.92 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|