C36H41IrN4O2- — CID 171746020
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;3-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)-1H-naphthalen-1-id-2-yl]isoquinoline;iridium (PubChem CID 171746020) has the molecular formula C36H41IrN4O2- and a molecular weight of 753.97 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;3-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)-1H-naphthalen-1-id-2-yl]isoquinoline;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;3-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)-1H-naphthalen-1-id-2-yl]isoquinoline;iridium |
|---|---|
| PubChem CID | 171746020 |
| Molecular Formula | C36H41IrN4O2- |
| Molecular Weight | 753.97 g/mol |
| Exact Mass | 754.29 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;3-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)-1H-naphthalen-1-id-2-yl]isoquinoline;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1nnc(C)n1-c1cc(-c2cc3ccccc3cn2)[c-]c2ccccc12.[Ir] |
| InChI | InChI=1S/C23H17N4.C13H24O2.Ir/c1-15-25-26-16(2)27(15)23-13-20(11-18-8-5-6-10-21(18)23)22-12-17-7-3-4-9-19(17)14-24-22;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-10,12-14H,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | WEMUYUBEGAIILR-DZTQYQPZSA-N |
| XLogP | 8.92 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.97 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|