C42H53IrN2O2- — CID 171450465
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;8-(2-methylpropyl)-2-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-5,6-dihydro-3,7-phenanthroline (PubChem CID 171450465) has the molecular formula C42H53IrN2O2- and a molecular weight of 810.11 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;8-(2-methylpropyl)-2-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-5,6-dihydro-3,7-phenanthroline.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;8-(2-methylpropyl)-2-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-5,6-dihydro-3,7-phenanthroline |
|---|---|
| PubChem CID | 171450465 |
| Molecular Formula | C42H53IrN2O2- |
| Molecular Weight | 810.11 g/mol |
| Exact Mass | 810.37 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;8-(2-methylpropyl)-2-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-5,6-dihydro-3,7-phenanthroline |
| SMILES | CC(C)Cc1ccc2c(n1)CCc1cnc(-c3[c-]c4ccccc4c(C(C)C)c3)cc1-2.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C29H29N2.C13H24O2.Ir/c1-18(2)13-23-10-11-25-27-16-29(30-17-21(27)9-12-28(25)31-23)22-14-20-7-5-6-8-24(20)26(15-22)19(3)4;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-8,10-11,15-19H,9,12-13H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | DNNDTWHSPDRSOY-DZTQYQPZSA-N |
| XLogP | 11.05 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.11 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|