C41H51IrN2O2- — CID 171450488
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;8-propan-2-yl-2-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-5,6-dihydrobenzo[h]quinazoline (PubChem CID 171450488) has the molecular formula C41H51IrN2O2- and a molecular weight of 796.09 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;8-propan-2-yl-2-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-5,6-dihydrobenzo[h]quinazoline.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;8-propan-2-yl-2-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-5,6-dihydrobenzo[h]quinazoline |
|---|---|
| PubChem CID | 171450488 |
| Molecular Formula | C41H51IrN2O2- |
| Molecular Weight | 796.09 g/mol |
| Exact Mass | 796.36 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;8-propan-2-yl-2-(4-propan-2-yl-1H-naphthalen-1-id-2-yl)-5,6-dihydrobenzo[h]quinazoline |
| SMILES | CC(C)c1ccc2c(c1)CCc1cnc(-c3[c-]c4ccccc4c(C(C)C)c3)nc1-2.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C28H27N2.C13H24O2.Ir/c1-17(2)19-11-12-25-21(13-19)9-10-22-16-29-28(30-27(22)25)23-14-20-7-5-6-8-24(20)26(15-23)18(3)4;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-8,11-13,15-18H,9-10H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | GWIMWSNSKNGJAN-DZTQYQPZSA-N |
| XLogP | 10.98 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.09 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|