About CID 177120075
CID 177120075 (PubChem CID 177120075) has the molecular formula C42H49IrN2O2-
and a molecular weight of 806.08 g/mol.
Molecular Properties
| Compound Name | CID 177120075 |
| PubChem CID | 177120075 |
| Molecular Formula | C42H49IrN2O2- |
| Molecular Weight | 806.08 g/mol |
| Exact Mass | 806.34 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1c2ccc(CC(C)(C)C)cc2n2c3cccnc3c3[c-]c4ccccc4cc3c12.[Ir] |
| InChI | InChI=1S/C29H25N2.C13H24O2.Ir/c1-18-22-12-11-19(17-29(2,3)4)14-26(22)31-25-10-7-13-30-27(25)23-15-20-8-5-6-9-21(20)16-24(23)28(18)31;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-14,16H,17H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | ZQBODKJBSKNUCY-DZTQYQPZSA-N |
| XLogP | 11.51 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 806.08 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 177120075 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177120075?
The IUPAC name of CID 177120075 (CID 177120075) is not available.
What is the SMILES notation for CID 177120075?
The canonical SMILES for CID 177120075 is CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1c2ccc(CC(C)(C)C)cc2n2c3cccnc3c3[c-]c4ccccc4cc3c12.[Ir].
What is the InChIKey of CID 177120075?
The InChIKey is ZQBODKJBSKNUCY-DZTQYQPZSA-N. The full InChI is InChI=1S/C29H25N2.C13H24O2.Ir/c1-18-22-12-11-19(17-29(2,3)4)14-26(22)31-25-10-7-13-30-27(25)23-15-20-8-5-6-9-21(20)16-24(23)28(18)31;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-14,16H,17H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;.
What are the key properties of CID 177120075?
CID 177120075 has a molecular weight of 806.08 g/mol, XLogP of 11.51, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177120075 is sourced from PubChem (CID 177120075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).