C46H49F3IrNO2Se- — CID 168721175
CID 168721175 (PubChem CID 168721175) has the molecular formula C46H49F3IrNO2Se- and a molecular weight of 976.07 g/mol.
| Compound Name | CID 168721175 |
|---|---|
| PubChem CID | 168721175 |
| Molecular Formula | C46H49F3IrNO2Se- |
| Molecular Weight | 976.07 g/mol |
| Exact Mass | 977.25 |
| IUPAC Name | — |
| SMILES | CC(C)(C)Cc1ccc(-c2ccc(-c3c(C(F)(F)F)cnc4c3[se]c3cc5ccccc5[c-]c34)cc2)cc1.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C33H25F3NSe.C13H24O2.Ir/c1-32(2,3)18-20-8-10-21(11-9-20)22-12-14-23(15-13-22)29-27(33(34,35)36)19-37-30-26-16-24-6-4-5-7-25(24)17-28(26)38-31(29)30;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-15,17,19H,18H2,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | WTJVYNUCWOLDFF-DZTQYQPZSA-N |
| XLogP | 13.21 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.07 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|