C53H60IrNO2Si- — CID 176585723
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;(5,5,6,6,7-pentamethyl-12H-naphtho[2,3-h]quinolin-12-id-4-yl)-triphenylsilane (PubChem CID 176585723) has the molecular formula C53H60IrNO2Si- and a molecular weight of 963.37 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;(5,5,6,6,7-pentamethyl-12H-naphtho[2,3-h]quinolin-12-id-4-yl)-triphenylsilane.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;(5,5,6,6,7-pentamethyl-12H-naphtho[2,3-h]quinolin-12-id-4-yl)-triphenylsilane |
|---|---|
| PubChem CID | 176585723 |
| Molecular Formula | C53H60IrNO2Si- |
| Molecular Weight | 963.37 g/mol |
| Exact Mass | 963.40 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;(5,5,6,6,7-pentamethyl-12H-naphtho[2,3-h]quinolin-12-id-4-yl)-triphenylsilane |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1c2c([c-]c3ccccc13)-c1nccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c1C(C)(C)C2(C)C.[Ir] |
| InChI | InChI=1S/C40H36NSi.C13H24O2.Ir/c1-28-33-24-16-15-17-29(33)27-34-36(28)39(2,3)40(4,5)37-35(25-26-41-38(34)37)42(30-18-9-6-10-19-30,31-20-11-7-12-21-31)32-22-13-8-14-23-32;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-26H,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | WKTPUZGOBADTHN-DZTQYQPZSA-N |
| XLogP | 10.82 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.37 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|