C46H60IrNO2- — CID 176585562
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-[4-(2,2-dimethylpropyl)phenyl]-5,5,6,6,7-pentamethyl-12H-naphtho[2,3-h]quinolin-12-ide;iridium (PubChem CID 176585562) has the molecular formula C46H60IrNO2- and a molecular weight of 851.21 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-[4-(2,2-dimethylpropyl)phenyl]-5,5,6,6,7-pentamethyl-12H-naphtho[2,3-h]quinolin-12-ide;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-[4-(2,2-dimethylpropyl)phenyl]-5,5,6,6,7-pentamethyl-12H-naphtho[2,3-h]quinolin-12-ide;iridium |
|---|---|
| PubChem CID | 176585562 |
| Molecular Formula | C46H60IrNO2- |
| Molecular Weight | 851.21 g/mol |
| Exact Mass | 851.43 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;4-[4-(2,2-dimethylpropyl)phenyl]-5,5,6,6,7-pentamethyl-12H-naphtho[2,3-h]quinolin-12-ide;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1c2c([c-]c3ccccc13)-c1nccc(-c3ccc(CC(C)(C)C)cc3)c1C(C)(C)C2(C)C.[Ir] |
| InChI | InChI=1S/C33H36N.C13H24O2.Ir/c1-21-25-12-10-9-11-24(25)19-27-28(21)32(5,6)33(7,8)29-26(17-18-34-30(27)29)23-15-13-22(14-16-23)20-31(2,3)4;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h9-18H,20H2,1-8H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | WKZYXHBGMDBNPU-DZTQYQPZSA-N |
| XLogP | 12.70 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.21 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|