About CID 177095973
CID 177095973 (PubChem CID 177095973) has the molecular formula C35H37IrN2O2-
and a molecular weight of 709.91 g/mol.
Molecular Properties
| Compound Name | CID 177095973 |
| PubChem CID | 177095973 |
| Molecular Formula | C35H37IrN2O2- |
| Molecular Weight | 709.91 g/mol |
| Exact Mass | 710.25 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1c2ccccc2[c-]c2c1c1cccc3cc4ccnc2n4c31.[Ir] |
| InChI | InChI=1S/C22H13N2.C13H24O2.Ir/c1-13-17-7-3-2-5-14(17)12-19-20(13)18-8-4-6-15-11-16-9-10-23-22(19)24(16)21(15)18;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h2-11H,1H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | FTZCEIYESCJXCH-DZTQYQPZSA-N |
| XLogP | 9.36 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 709.91 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 177095973 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177095973?
The IUPAC name of CID 177095973 (CID 177095973) is not available.
What is the SMILES notation for CID 177095973?
The canonical SMILES for CID 177095973 is CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1c2ccccc2[c-]c2c1c1cccc3cc4ccnc2n4c31.[Ir].
What is the InChIKey of CID 177095973?
The InChIKey is FTZCEIYESCJXCH-DZTQYQPZSA-N. The full InChI is InChI=1S/C22H13N2.C13H24O2.Ir/c1-13-17-7-3-2-5-14(17)12-19-20(13)18-8-4-6-15-11-16-9-10-23-22(19)24(16)21(15)18;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h2-11H,1H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;.
What are the key properties of CID 177095973?
CID 177095973 has a molecular weight of 709.91 g/mol, XLogP of 9.36, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177095973 is sourced from PubChem (CID 177095973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).