C41H28IrN2O-2 — CID 176880931
CID 176880931 (PubChem CID 176880931) has the molecular formula C41H28IrN2O-2 and a molecular weight of 756.91 g/mol.
| Compound Name | CID 176880931 |
|---|---|
| PubChem CID | 176880931 |
| Molecular Formula | C41H28IrN2O-2 |
| Molecular Weight | 756.91 g/mol |
| Exact Mass | 757.18 |
| IUPAC Name | — |
| SMILES | Cc1c[c-]c(-c2cc(C)c(C)cn2)cc1.[Ir].[c-]1c2c(cc3ccccc13)Oc1cc3c4ccccc4ccc3c3ccnc-2c13 |
| InChI | InChI=1S/C27H14NO.C14H14N.Ir/c1-2-7-18-14-24-23(13-17(18)6-1)27-26-21(11-12-28-27)20-10-9-16-5-3-4-8-19(16)22(20)15-25(26)29-24;1-10-4-6-13(7-5-10)14-8-11(2)12(3)9-15-14;/h1-12,14-15H;4-6,8-9H,1-3H3;/q2*-1; |
| InChIKey | DOYFUOCNOZLRMC-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.91 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|